C25H27N2Se2+ — CID 59729862
(2Z)-3-ethyl-2-[(2E,4E,6E)-7-(3-ethyl-2,3-dihydro-1,3-benzoselenazol-3-ium-2-yl)hepta-2,4,6-trienylidene]-1,3-benzoselenazole (PubChem CID 59729862) has the molecular formula C25H27N2Se2+ and a molecular weight of 513.43 g/mol. Its IUPAC name is (2Z)-3-ethyl-2-[(2E,4E,6E)-7-(3-ethyl-2,3-dihydro-1,3-benzoselenazol-3-ium-2-yl)hepta-2,4,6-trienylidene]-1,3-benzoselenazole.
| Compound Name | (2Z)-3-ethyl-2-[(2E,4E,6E)-7-(3-ethyl-2,3-dihydro-1,3-benzoselenazol-3-ium-2-yl)hepta-2,4,6-trienylidene]-1,3-benzoselenazole |
|---|---|
| PubChem CID | 59729862 |
| Molecular Formula | C25H27N2Se2+ |
| Molecular Weight | 513.43 g/mol |
| Exact Mass | 515.05 |
| IUPAC Name | (2Z)-3-ethyl-2-[(2E,4E,6E)-7-(3-ethyl-2,3-dihydro-1,3-benzoselenazol-3-ium-2-yl)hepta-2,4,6-trienylidene]-1,3-benzoselenazole |
| SMILES | CCN1/C(=C/C=C/C=C/C=C/C2[Se]c3ccccc3[NH+]2CC)[Se]c2ccccc21 |
| InChI | InChI=1S/C25H26N2Se2/c1-3-26-20-14-10-12-16-22(20)28-24(26)18-8-6-5-7-9-19-25-27(4-2)21-15-11-13-17-23(21)29-25/h5-19,24H,3-4H2,1-2H3/p+1/b6-5+,9-7+,18-8+,25-19- |
| InChIKey | LXODVIMZSSHUDL-YEAYPVSASA-O |
| XLogP | 2.27 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.43 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|