C21H23IN2S2 — CID 159299617
3-ethyl-2-[3-(3-ethyl-2,3-dihydro-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-1,3-benzothiazole iodide (PubChem CID 159299617) has the molecular formula C21H23IN2S2 and a molecular weight of 494.47 g/mol. Its IUPAC name is 3-ethyl-2-[3-(3-ethyl-2,3-dihydro-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-1,3-benzothiazole iodide.
| Compound Name | 3-ethyl-2-[3-(3-ethyl-2,3-dihydro-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-1,3-benzothiazole iodide |
|---|---|
| PubChem CID | 159299617 |
| Molecular Formula | C21H23IN2S2 |
| Molecular Weight | 494.47 g/mol |
| Exact Mass | 494.03 |
| IUPAC Name | 3-ethyl-2-[3-(3-ethyl-2,3-dihydro-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-1,3-benzothiazole iodide |
| SMILES | CCN1C(=CC=CC2Sc3ccccc3[NH+]2CC)Sc2ccccc21.[I-] |
| InChI | InChI=1S/C21H22N2S2.HI/c1-3-22-16-10-5-7-12-18(16)24-20(22)14-9-15-21-23(4-2)17-11-6-8-13-19(17)25-21;/h5-15,20H,3-4H2,1-2H3;1H |
| InChIKey | ILGKZRNDJFVKBZ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.47 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|