C19H19IN2S2Te — CID 88602637
2-[3-(3-ethyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]-3-methyl-5H-telluropyrano[2,3-d][1,3]thiazol-3-ium iodide (PubChem CID 88602637) has the molecular formula C19H19IN2S2Te and a molecular weight of 594.01 g/mol. Its IUPAC name is 2-[3-(3-ethyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]-3-methyl-5H-telluropyrano[2,3-d][1,3]thiazol-3-ium iodide.
| Compound Name | 2-[3-(3-ethyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]-3-methyl-5H-telluropyrano[2,3-d][1,3]thiazol-3-ium iodide |
|---|---|
| PubChem CID | 88602637 |
| Molecular Formula | C19H19IN2S2Te |
| Molecular Weight | 594.01 g/mol |
| Exact Mass | 595.91 |
| IUPAC Name | 2-[3-(3-ethyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]-3-methyl-5H-telluropyrano[2,3-d][1,3]thiazol-3-ium iodide |
| SMILES | CCN1C(=CC=Cc2sc3c([n+]2C)[Te]CC=C3)Sc2ccccc21.[I-] |
| InChI | InChI=1S/C19H19N2S2Te.HI/c1-3-21-14-8-4-5-9-15(14)22-18(21)12-6-11-17-20(2)19-16(23-17)10-7-13-24-19;/h4-12H,3,13H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | NCJSRPZPWABWFL-UHFFFAOYSA-M |
| XLogP | 0.84 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.01 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|