C24H24N3OSe2+ — CID 59043309
2-[2-(3-ethyl-1,3-benzoselenazol-3-ium-2-yl)ethenyl]-4-(3-ethyl-1,3-benzoselenazol-2-ylidene)but-2-enamide (PubChem CID 59043309) has the molecular formula C24H24N3OSe2+ and a molecular weight of 528.40 g/mol. Its IUPAC name is 2-[2-(3-ethyl-1,3-benzoselenazol-3-ium-2-yl)ethenyl]-4-(3-ethyl-1,3-benzoselenazol-2-ylidene)but-2-enamide.
| Compound Name | 2-[2-(3-ethyl-1,3-benzoselenazol-3-ium-2-yl)ethenyl]-4-(3-ethyl-1,3-benzoselenazol-2-ylidene)but-2-enamide |
|---|---|
| PubChem CID | 59043309 |
| Molecular Formula | C24H24N3OSe2+ |
| Molecular Weight | 528.40 g/mol |
| Exact Mass | 530.02 |
| IUPAC Name | 2-[2-(3-ethyl-1,3-benzoselenazol-3-ium-2-yl)ethenyl]-4-(3-ethyl-1,3-benzoselenazol-2-ylidene)but-2-enamide |
| SMILES | CCN1C(=CC=C(C=Cc2[se]c3ccccc3[n+]2CC)C(N)=O)[Se]c2ccccc21 |
| InChI | InChI=1S/C24H23N3OSe2/c1-3-26-18-9-5-7-11-20(18)29-22(26)15-13-17(24(25)28)14-16-23-27(4-2)19-10-6-8-12-21(19)30-23/h5-16H,3-4H2,1-2H3,(H-,25,28)/p+1 |
| InChIKey | IXAASVFXIAAQNJ-UHFFFAOYSA-O |
| XLogP | 2.34 |
| TPSA | 50.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.40 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|