C23H24N2Se2 — CID 163147517
3-ethyl-2-[5-(3-ethyl-2H-1,3-benzoselenazol-2-yl)penta-2,4-dienylidene]-1,3-benzoselenazole (PubChem CID 163147517) has the molecular formula C23H24N2Se2 and a molecular weight of 486.38 g/mol. Its IUPAC name is 3-ethyl-2-[5-(3-ethyl-2H-1,3-benzoselenazol-2-yl)penta-2,4-dienylidene]-1,3-benzoselenazole.
| Compound Name | 3-ethyl-2-[5-(3-ethyl-2H-1,3-benzoselenazol-2-yl)penta-2,4-dienylidene]-1,3-benzoselenazole |
|---|---|
| PubChem CID | 163147517 |
| Molecular Formula | C23H24N2Se2 |
| Molecular Weight | 486.38 g/mol |
| Exact Mass | 488.03 |
| IUPAC Name | 3-ethyl-2-[5-(3-ethyl-2H-1,3-benzoselenazol-2-yl)penta-2,4-dienylidene]-1,3-benzoselenazole |
| SMILES | CCN1C(=CC=CC=CC2[Se]c3ccccc3N2CC)[Se]c2ccccc21 |
| InChI | InChI=1S/C23H24N2Se2/c1-3-24-18-12-8-10-14-20(18)26-22(24)16-6-5-7-17-23-25(4-2)19-13-9-11-15-21(19)27-23/h5-17,22H,3-4H2,1-2H3 |
| InChIKey | MCZXNUZRBOFEMA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.38 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|