C23H26N2NaO7S2Se2+ — CID 90659645
sodium 3-[5-methoxy-2-[(E)-[5-methyl-3-(3-sulfopropyl)-1,3-benzoselenazol-2-ylidene]methyl]-1,3-benzoselenazol-3-ium-3-yl]propane-1-sulfonate (PubChem CID 90659645) has the molecular formula C23H26N2NaO7S2Se2+ and a molecular weight of 687.51 g/mol. Its IUPAC name is sodium 3-[5-methoxy-2-[(E)-[5-methyl-3-(3-sulfopropyl)-1,3-benzoselenazol-2-ylidene]methyl]-1,3-benzoselenazol-3-ium-3-yl]propane-1-sulfonate.
| Compound Name | sodium 3-[5-methoxy-2-[(E)-[5-methyl-3-(3-sulfopropyl)-1,3-benzoselenazol-2-ylidene]methyl]-1,3-benzoselenazol-3-ium-3-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 90659645 |
| Molecular Formula | C23H26N2NaO7S2Se2+ |
| Molecular Weight | 687.51 g/mol |
| Exact Mass | 688.94 |
| IUPAC Name | sodium 3-[5-methoxy-2-[(E)-[5-methyl-3-(3-sulfopropyl)-1,3-benzoselenazol-2-ylidene]methyl]-1,3-benzoselenazol-3-ium-3-yl]propane-1-sulfonate |
| SMILES | COc1ccc2[se]c(/C=C3/[Se]c4ccc(C)cc4N3CCCS(=O)(=O)O)[n+](CCCS(=O)(=O)[O-])c2c1.[Na+] |
| InChI | InChI=1S/C23H26N2O7S2Se2.Na/c1-16-5-7-20-18(13-16)24(9-3-11-33(26,27)28)22(35-20)15-23-25(10-4-12-34(29,30)31)19-14-17(32-2)6-8-21(19)36-23;/h5-8,13-15H,3-4,9-12H2,1-2H3,(H-,26,27,28,29,30,31);/q;+1 |
| InChIKey | ATCRRTZLWREEPW-UHFFFAOYSA-N |
| XLogP | -2.13 |
| TPSA | 127.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.51 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|