C36H33N2O4Se+ — CID 58471144
3-[(2Z)-2-[(2E,4E)-5-[3-(2-formyloxyethyl)-1,3-benzoselenazol-3-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethylphenanthro[9,10-b]pyrrol-1-yl]propanoic acid (PubChem CID 58471144) has the molecular formula C36H33N2O4Se+ and a molecular weight of 636.63 g/mol. Its IUPAC name is 3-[(2Z)-2-[(2E,4E)-5-[3-(2-formyloxyethyl)-1,3-benzoselenazol-3-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethylphenanthro[9,10-b]pyrrol-1-yl]propanoic acid.
| Compound Name | 3-[(2Z)-2-[(2E,4E)-5-[3-(2-formyloxyethyl)-1,3-benzoselenazol-3-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethylphenanthro[9,10-b]pyrrol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 58471144 |
| Molecular Formula | C36H33N2O4Se+ |
| Molecular Weight | 636.63 g/mol |
| Exact Mass | 637.16 |
| IUPAC Name | 3-[(2Z)-2-[(2E,4E)-5-[3-(2-formyloxyethyl)-1,3-benzoselenazol-3-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethylphenanthro[9,10-b]pyrrol-1-yl]propanoic acid |
| SMILES | CC1(C)/C(=C/C=C/C=C/c2[se]c3ccccc3[n+]2CCOC=O)N(CCC(=O)O)c2c1c1ccccc1c1ccccc21 |
| InChI | InChI=1S/C36H32N2O4Se/c1-36(2)31(18-4-3-5-19-32-37(22-23-42-24-39)29-16-10-11-17-30(29)43-32)38(21-20-33(40)41)35-28-15-9-7-13-26(28)25-12-6-8-14-27(25)34(35)36/h3-19,24H,20-23H2,1-2H3/p+1 |
| InChIKey | VSPMJKKZHGFNRI-UHFFFAOYSA-O |
| XLogP | 6.39 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.63 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|