C32H33N2O4S+ — CID 144799147
3-[(2Z)-2-[(2E,4E)-5-[3-(2-carboxyethyl)-4,5-dihydro-1,3-thiazol-3-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethylphenanthro[9,10-b]pyrrol-1-yl]propanoic acid (PubChem CID 144799147) has the molecular formula C32H33N2O4S+ and a molecular weight of 541.69 g/mol. Its IUPAC name is 3-[(2Z)-2-[(2E,4E)-5-[3-(2-carboxyethyl)-4,5-dihydro-1,3-thiazol-3-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethylphenanthro[9,10-b]pyrrol-1-yl]propanoic acid.
| Compound Name | 3-[(2Z)-2-[(2E,4E)-5-[3-(2-carboxyethyl)-4,5-dihydro-1,3-thiazol-3-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethylphenanthro[9,10-b]pyrrol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 144799147 |
| Molecular Formula | C32H33N2O4S+ |
| Molecular Weight | 541.69 g/mol |
| Exact Mass | 541.22 |
| IUPAC Name | 3-[(2Z)-2-[(2E,4E)-5-[3-(2-carboxyethyl)-4,5-dihydro-1,3-thiazol-3-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethylphenanthro[9,10-b]pyrrol-1-yl]propanoic acid |
| SMILES | CC1(C)/C(=C/C=C/C=C/C2=[N+](CCC(=O)O)CCS2)N(CCC(=O)O)c2c1c1ccccc1c1ccccc21 |
| InChI | InChI=1S/C32H32N2O4S/c1-32(2)26(14-4-3-5-15-27-33(20-21-39-27)18-16-28(35)36)34(19-17-29(37)38)31-25-13-9-7-11-23(25)22-10-6-8-12-24(22)30(31)32/h3-15H,16-21H2,1-2H3,(H-,35,36,37,38)/p+1 |
| InChIKey | SBBTXNGFDIQICE-UHFFFAOYSA-O |
| XLogP | 6.19 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.69 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|