C46H41N2O4S+ — CID 123260406
3-[(2Z)-2-[(2E)-5-[3-(2-formyloxyethyl)phenanthro[9,10-d][1,3]thiazol-3-ium-2-yl]-3-methylhexa-2,4-dienylidene]-3,3-dimethylphenanthro[9,10-b]pyrrol-1-yl]propanoic acid (PubChem CID 123260406) has the molecular formula C46H41N2O4S+ and a molecular weight of 717.91 g/mol. Its IUPAC name is 3-[(2Z)-2-[(2E)-5-[3-(2-formyloxyethyl)phenanthro[9,10-d][1,3]thiazol-3-ium-2-yl]-3-methylhexa-2,4-dienylidene]-3,3-dimethylphenanthro[9,10-b]pyrrol-1-yl]propanoic acid.
| Compound Name | 3-[(2Z)-2-[(2E)-5-[3-(2-formyloxyethyl)phenanthro[9,10-d][1,3]thiazol-3-ium-2-yl]-3-methylhexa-2,4-dienylidene]-3,3-dimethylphenanthro[9,10-b]pyrrol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 123260406 |
| Molecular Formula | C46H41N2O4S+ |
| Molecular Weight | 717.91 g/mol |
| Exact Mass | 717.28 |
| IUPAC Name | 3-[(2Z)-2-[(2E)-5-[3-(2-formyloxyethyl)phenanthro[9,10-d][1,3]thiazol-3-ium-2-yl]-3-methylhexa-2,4-dienylidene]-3,3-dimethylphenanthro[9,10-b]pyrrol-1-yl]propanoic acid |
| SMILES | CC(=C/C(C)=C/C=C1\N(CCC(=O)O)c2c(c3ccccc3c3ccccc23)C1(C)C)c1sc2c3ccccc3c3ccccc3c2[n+]1CCOC=O |
| InChI | InChI=1S/C46H40N2O4S/c1-29(27-30(2)45-48(25-26-52-28-49)43-37-19-11-7-15-33(37)34-16-8-12-20-38(34)44(43)53-45)21-22-39-46(3,4)41-35-17-9-5-13-31(35)32-14-6-10-18-36(32)42(41)47(39)24-23-40(50)51/h5-22,27-28H,23-26H2,1-4H3/p+1 |
| InChIKey | ZIBUAWBYEMBARR-UHFFFAOYSA-O |
| XLogP | 10.48 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.91 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|