C41H31N2O5S+ — CID 58471206
3-[(2E)-2-[(2E,4E)-5-[3-(2-formyloxyethyl)phenanthro[9,10-d][1,3]thiazol-3-ium-2-yl]penta-2,4-dienylidene]phenanthro[9,10-d][1,3]oxazol-3-yl]propanoic acid (PubChem CID 58471206) has the molecular formula C41H31N2O5S+ and a molecular weight of 663.78 g/mol. Its IUPAC name is 3-[(2E)-2-[(2E,4E)-5-[3-(2-formyloxyethyl)phenanthro[9,10-d][1,3]thiazol-3-ium-2-yl]penta-2,4-dienylidene]phenanthro[9,10-d][1,3]oxazol-3-yl]propanoic acid.
| Compound Name | 3-[(2E)-2-[(2E,4E)-5-[3-(2-formyloxyethyl)phenanthro[9,10-d][1,3]thiazol-3-ium-2-yl]penta-2,4-dienylidene]phenanthro[9,10-d][1,3]oxazol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 58471206 |
| Molecular Formula | C41H31N2O5S+ |
| Molecular Weight | 663.78 g/mol |
| Exact Mass | 663.19 |
| IUPAC Name | 3-[(2E)-2-[(2E,4E)-5-[3-(2-formyloxyethyl)phenanthro[9,10-d][1,3]thiazol-3-ium-2-yl]penta-2,4-dienylidene]phenanthro[9,10-d][1,3]oxazol-3-yl]propanoic acid |
| SMILES | O=COCC[n+]1c(/C=C/C=C/C=C2/Oc3c(c4ccccc4c4ccccc34)N2CCC(=O)O)sc2c3ccccc3c3ccccc3c21 |
| InChI | InChI=1S/C41H30N2O5S/c44-26-47-25-24-43-36(49-41-34-19-11-7-15-30(34)28-13-5-9-17-32(28)39(41)43)21-3-1-2-20-35-42(23-22-37(45)46)38-31-16-8-4-12-27(31)29-14-6-10-18-33(29)40(38)48-35/h1-21,26H,22-25H2/p+1 |
| InChIKey | RJPZZZLNAZCVSK-UHFFFAOYSA-O |
| XLogP | 8.76 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.78 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|