C34H38N3O4+ — CID 58471255
3-[(2Z)-2-[(2E,4E)-5-[1-ethyl-3-(2-formyloxyethyl)-4,5-dihydroimidazol-3-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethylphenanthro[9,10-b]pyrrol-1-yl]propanoic acid (PubChem CID 58471255) has the molecular formula C34H38N3O4+ and a molecular weight of 552.70 g/mol. Its IUPAC name is 3-[(2Z)-2-[(2E,4E)-5-[1-ethyl-3-(2-formyloxyethyl)-4,5-dihydroimidazol-3-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethylphenanthro[9,10-b]pyrrol-1-yl]propanoic acid.
| Compound Name | 3-[(2Z)-2-[(2E,4E)-5-[1-ethyl-3-(2-formyloxyethyl)-4,5-dihydroimidazol-3-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethylphenanthro[9,10-b]pyrrol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 58471255 |
| Molecular Formula | C34H38N3O4+ |
| Molecular Weight | 552.70 g/mol |
| Exact Mass | 552.29 |
| IUPAC Name | 3-[(2Z)-2-[(2E,4E)-5-[1-ethyl-3-(2-formyloxyethyl)-4,5-dihydroimidazol-3-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethylphenanthro[9,10-b]pyrrol-1-yl]propanoic acid |
| SMILES | CCN1CC[N+](CCOC=O)=C1/C=C/C=C/C=C1\N(CCC(=O)O)c2c(c3ccccc3c3ccccc23)C1(C)C |
| InChI | InChI=1S/C34H37N3O4/c1-4-35-20-21-36(22-23-41-24-38)30(35)17-7-5-6-16-29-34(2,3)32-27-14-10-8-12-25(27)26-13-9-11-15-28(26)33(32)37(29)19-18-31(39)40/h5-17,24H,4,18-23H2,1-3H3/p+1 |
| InChIKey | OMZMVLQKVAEOFG-UHFFFAOYSA-O |
| XLogP | 5.48 |
| TPSA | 73.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.70 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|