C40H38F3N2O5+ — CID 76796768
3-[2-[5-[1-(2-formyloxyethyl)-3,3-dimethyl-5-(trifluoromethoxy)indol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylphenanthro[9,10-b]pyrrol-1-ium-1-yl]propanoic acid (PubChem CID 76796768) has the molecular formula C40H38F3N2O5+ and a molecular weight of 683.75 g/mol. Its IUPAC name is 3-[2-[5-[1-(2-formyloxyethyl)-3,3-dimethyl-5-(trifluoromethoxy)indol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylphenanthro[9,10-b]pyrrol-1-ium-1-yl]propanoic acid.
| Compound Name | 3-[2-[5-[1-(2-formyloxyethyl)-3,3-dimethyl-5-(trifluoromethoxy)indol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylphenanthro[9,10-b]pyrrol-1-ium-1-yl]propanoic acid |
|---|---|
| PubChem CID | 76796768 |
| Molecular Formula | C40H38F3N2O5+ |
| Molecular Weight | 683.75 g/mol |
| Exact Mass | 683.27 |
| IUPAC Name | 3-[2-[5-[1-(2-formyloxyethyl)-3,3-dimethyl-5-(trifluoromethoxy)indol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylphenanthro[9,10-b]pyrrol-1-ium-1-yl]propanoic acid |
| SMILES | CC1(C)C(=CC=CC=CC2=[N+](CCC(=O)O)c3c(c4ccccc4c4ccccc34)C2(C)C)N(CCOC=O)c2ccc(OC(F)(F)F)cc21 |
| InChI | InChI=1S/C40H37F3N2O5/c1-38(2)31-24-26(50-40(41,42)43)18-19-32(31)44(22-23-49-25-46)33(38)16-6-5-7-17-34-39(3,4)36-29-14-10-8-12-27(29)28-13-9-11-15-30(28)37(36)45(34)21-20-35(47)48/h5-19,24-25H,20-23H2,1-4H3/p+1 |
| InChIKey | LNXMPYIXVVOHPL-UHFFFAOYSA-O |
| XLogP | 8.71 |
| TPSA | 79.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.75 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|