C51H46ClN2O4+ — CID 58471143
3-[2-[(1E,3Z,5Z)-3-chloro-5-[3,3-dibenzyl-1-(2-formyloxyethyl)indol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylphenanthro[9,10-b]pyrrol-1-ium-1-yl]propanoic acid (PubChem CID 58471143) has the molecular formula C51H46ClN2O4+ and a molecular weight of 786.39 g/mol. Its IUPAC name is 3-[2-[(1E,3Z,5Z)-3-chloro-5-[3,3-dibenzyl-1-(2-formyloxyethyl)indol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylphenanthro[9,10-b]pyrrol-1-ium-1-yl]propanoic acid.
| Compound Name | 3-[2-[(1E,3Z,5Z)-3-chloro-5-[3,3-dibenzyl-1-(2-formyloxyethyl)indol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylphenanthro[9,10-b]pyrrol-1-ium-1-yl]propanoic acid |
|---|---|
| PubChem CID | 58471143 |
| Molecular Formula | C51H46ClN2O4+ |
| Molecular Weight | 786.39 g/mol |
| Exact Mass | 785.31 |
| IUPAC Name | 3-[2-[(1E,3Z,5Z)-3-chloro-5-[3,3-dibenzyl-1-(2-formyloxyethyl)indol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylphenanthro[9,10-b]pyrrol-1-ium-1-yl]propanoic acid |
| SMILES | CC1(C)C(/C=C/C(Cl)=C/C=C2\N(CCOC=O)c3ccccc3C2(Cc2ccccc2)Cc2ccccc2)=[N+](CCC(=O)O)c2c1c1ccccc1c1ccccc21 |
| InChI | InChI=1S/C51H45ClN2O4/c1-50(2)45(54(30-29-47(56)57)49-42-22-12-10-20-40(42)39-19-9-11-21-41(39)48(49)50)27-25-38(52)26-28-46-51(33-36-15-5-3-6-16-36,34-37-17-7-4-8-18-37)43-23-13-14-24-44(43)53(46)31-32-58-35-55/h3-28,35H,29-34H2,1-2H3/p+1 |
| InChIKey | UOYCTSSPQFUISE-UHFFFAOYSA-O |
| XLogP | 10.82 |
| TPSA | 69.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.39 |
| LogP ≤ 5 | 10.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|