C38H44ClN2O4+ — CID 58527229
4-[2-[(2E)-2-[2-chloro-3-[(E)-2-[1-(3-formyloxypropyl)-3,3-dimethylindol-1-ium-2-yl]ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-3,3-dimethylindol-1-yl]butanoic acid (PubChem CID 58527229) has the molecular formula C38H44ClN2O4+ and a molecular weight of 628.23 g/mol. Its IUPAC name is 4-[2-[(2E)-2-[2-chloro-3-[(E)-2-[1-(3-formyloxypropyl)-3,3-dimethylindol-1-ium-2-yl]ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-3,3-dimethylindol-1-yl]butanoic acid.
| Compound Name | 4-[2-[(2E)-2-[2-chloro-3-[(E)-2-[1-(3-formyloxypropyl)-3,3-dimethylindol-1-ium-2-yl]ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-3,3-dimethylindol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 58527229 |
| Molecular Formula | C38H44ClN2O4+ |
| Molecular Weight | 628.23 g/mol |
| Exact Mass | 627.30 |
| IUPAC Name | 4-[2-[(2E)-2-[2-chloro-3-[(E)-2-[1-(3-formyloxypropyl)-3,3-dimethylindol-1-ium-2-yl]ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-3,3-dimethylindol-1-yl]butanoic acid |
| SMILES | CC1(C)C(=C/C=C2\CCCC(/C=C/C3=[N+](CCCOC=O)c4ccccc4C3(C)C)=C2Cl)N(CCCC(=O)O)c2ccccc21 |
| InChI | InChI=1S/C38H43ClN2O4/c1-37(2)29-14-5-7-16-31(29)40(23-10-18-35(43)44)33(37)21-19-27-12-9-13-28(36(27)39)20-22-34-38(3,4)30-15-6-8-17-32(30)41(34)24-11-25-45-26-42/h5-8,14-17,19-22,26H,9-13,18,23-25H2,1-4H3/p+1 |
| InChIKey | VPFLEIDRCJUJLG-UHFFFAOYSA-O |
| XLogP | 8.33 |
| TPSA | 69.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.23 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|