C42H52ClN2O4+ — CID 140825174
5-[(2E)-2-[(2E)-2-[2-chloro-3-[(E)-2-[1-(5-formyloxypentyl)-3,3-dimethylindol-1-ium-2-yl]ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-3,3-dimethylindol-1-yl]pentyl formate (PubChem CID 140825174) has the molecular formula C42H52ClN2O4+ and a molecular weight of 684.34 g/mol. Its IUPAC name is 5-[(2E)-2-[(2E)-2-[2-chloro-3-[(E)-2-[1-(5-formyloxypentyl)-3,3-dimethylindol-1-ium-2-yl]ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-3,3-dimethylindol-1-yl]pentyl formate.
| Compound Name | 5-[(2E)-2-[(2E)-2-[2-chloro-3-[(E)-2-[1-(5-formyloxypentyl)-3,3-dimethylindol-1-ium-2-yl]ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-3,3-dimethylindol-1-yl]pentyl formate |
|---|---|
| PubChem CID | 140825174 |
| Molecular Formula | C42H52ClN2O4+ |
| Molecular Weight | 684.34 g/mol |
| Exact Mass | 683.36 |
| IUPAC Name | 5-[(2E)-2-[(2E)-2-[2-chloro-3-[(E)-2-[1-(5-formyloxypentyl)-3,3-dimethylindol-1-ium-2-yl]ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-3,3-dimethylindol-1-yl]pentyl formate |
| SMILES | CC1(C)C(/C=C/C2=C(Cl)/C(=C/C=C3/N(CCCCCOC=O)c4ccccc4C3(C)C)CCC2)=[N+](CCCCCOC=O)c2ccccc21 |
| InChI | InChI=1S/C42H52ClN2O4/c1-41(2)34-18-7-9-20-36(34)44(26-11-5-13-28-48-30-46)38(41)24-22-32-16-15-17-33(40(32)43)23-25-39-42(3,4)35-19-8-10-21-37(35)45(39)27-12-6-14-29-49-31-47/h7-10,18-25,30-31H,5-6,11-17,26-29H2,1-4H3/q+1 |
| InChIKey | SYKGUVQZHDOUTC-UHFFFAOYSA-N |
| XLogP | 9.59 |
| TPSA | 58.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.34 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|