C39H50ClN2O5S2+ — CID 91122214
4-[2-[2-[2-chloro-3-[2-[3,3-dimethyl-1-(4-methylsulfonylbutyl)indol-2-ylidene]ethylidene]cyclohexen-1-yl]ethenyl]-3,3-dimethylindol-1-ium-1-yl]butane-1-sulfonic acid (PubChem CID 91122214) has the molecular formula C39H50ClN2O5S2+ and a molecular weight of 726.42 g/mol. Its IUPAC name is 4-[2-[2-[2-chloro-3-[2-[3,3-dimethyl-1-(4-methylsulfonylbutyl)indol-2-ylidene]ethylidene]cyclohexen-1-yl]ethenyl]-3,3-dimethylindol-1-ium-1-yl]butane-1-sulfonic acid.
| Compound Name | 4-[2-[2-[2-chloro-3-[2-[3,3-dimethyl-1-(4-methylsulfonylbutyl)indol-2-ylidene]ethylidene]cyclohexen-1-yl]ethenyl]-3,3-dimethylindol-1-ium-1-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 91122214 |
| Molecular Formula | C39H50ClN2O5S2+ |
| Molecular Weight | 726.42 g/mol |
| Exact Mass | 725.28 |
| IUPAC Name | 4-[2-[2-[2-chloro-3-[2-[3,3-dimethyl-1-(4-methylsulfonylbutyl)indol-2-ylidene]ethylidene]cyclohexen-1-yl]ethenyl]-3,3-dimethylindol-1-ium-1-yl]butane-1-sulfonic acid |
| SMILES | CC1(C)C(=CC=C2CCCC(C=CC3=[N+](CCCCS(=O)(=O)O)c4ccccc4C3(C)C)=C2Cl)N(CCCCS(C)(=O)=O)c2ccccc21 |
| InChI | InChI=1S/C39H49ClN2O5S2/c1-38(2)31-17-6-8-19-33(31)41(25-10-12-27-48(5,43)44)35(38)23-21-29-15-14-16-30(37(29)40)22-24-36-39(3,4)32-18-7-9-20-34(32)42(36)26-11-13-28-49(45,46)47/h6-9,17-24H,10-16,25-28H2,1-5H3/p+1 |
| InChIKey | IXMYDABCMWGGFI-UHFFFAOYSA-O |
| XLogP | 8.40 |
| TPSA | 94.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.42 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|