C40H49ClN2O5S — CID 157091320
4-[2-[2-[2-chloro-3-[2-[1-(5-formyloxypentyl)-3,3-dimethylindol-1-ium-2-yl]ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-3,3-dimethylindol-1-yl]butane-1-sulfonate (PubChem CID 157091320) has the molecular formula C40H49ClN2O5S and a molecular weight of 705.36 g/mol. Its IUPAC name is 4-[2-[2-[2-chloro-3-[2-[1-(5-formyloxypentyl)-3,3-dimethylindol-1-ium-2-yl]ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-3,3-dimethylindol-1-yl]butane-1-sulfonate.
| Compound Name | 4-[2-[2-[2-chloro-3-[2-[1-(5-formyloxypentyl)-3,3-dimethylindol-1-ium-2-yl]ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-3,3-dimethylindol-1-yl]butane-1-sulfonate |
|---|---|
| PubChem CID | 157091320 |
| Molecular Formula | C40H49ClN2O5S |
| Molecular Weight | 705.36 g/mol |
| Exact Mass | 704.31 |
| IUPAC Name | 4-[2-[2-[2-chloro-3-[2-[1-(5-formyloxypentyl)-3,3-dimethylindol-1-ium-2-yl]ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-3,3-dimethylindol-1-yl]butane-1-sulfonate |
| SMILES | CC1(C)C(=CC=C2CCCC(C=CC3=[N+](CCCCCOC=O)c4ccccc4C3(C)C)=C2Cl)N(CCCCS(=O)(=O)[O-])c2ccccc21 |
| InChI | InChI=1S/C40H49ClN2O5S/c1-39(2)32-17-6-8-19-34(32)42(25-10-5-12-27-48-29-44)36(39)23-21-30-15-14-16-31(38(30)41)22-24-37-40(3,4)33-18-7-9-20-35(33)43(37)26-11-13-28-49(45,46)47/h6-9,17-24,29H,5,10-16,25-28H2,1-4H3 |
| InChIKey | PYEHBGBCOHPAKH-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.36 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|