C41H53ClN3O+ — CID 160932542
6-[2-[2-[3-[2-(1-butyl-3,3-dimethylindol-2-ylidene)ethylidene]-2-chlorocyclohexen-1-yl]ethenyl]-3,3-dimethylindol-1-ium-1-yl]-N-methylhexanamide (PubChem CID 160932542) has the molecular formula C41H53ClN3O+ and a molecular weight of 639.35 g/mol. Its IUPAC name is 6-[2-[2-[3-[2-(1-butyl-3,3-dimethylindol-2-ylidene)ethylidene]-2-chlorocyclohexen-1-yl]ethenyl]-3,3-dimethylindol-1-ium-1-yl]-N-methylhexanamide.
| Compound Name | 6-[2-[2-[3-[2-(1-butyl-3,3-dimethylindol-2-ylidene)ethylidene]-2-chlorocyclohexen-1-yl]ethenyl]-3,3-dimethylindol-1-ium-1-yl]-N-methylhexanamide |
|---|---|
| PubChem CID | 160932542 |
| Molecular Formula | C41H53ClN3O+ |
| Molecular Weight | 639.35 g/mol |
| Exact Mass | 638.39 |
| IUPAC Name | 6-[2-[2-[3-[2-(1-butyl-3,3-dimethylindol-2-ylidene)ethylidene]-2-chlorocyclohexen-1-yl]ethenyl]-3,3-dimethylindol-1-ium-1-yl]-N-methylhexanamide |
| SMILES | CCCCN1C(=CC=C2CCCC(C=CC3=[N+](CCCCCC(=O)NC)c4ccccc4C3(C)C)=C2Cl)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C41H52ClN3O/c1-7-8-28-44-34-21-13-11-19-32(34)40(2,3)36(44)26-24-30-17-16-18-31(39(30)42)25-27-37-41(4,5)33-20-12-14-22-35(33)45(37)29-15-9-10-23-38(46)43-6/h11-14,19-22,24-27H,7-10,15-18,23,28-29H2,1-6H3/p+1 |
| InChIKey | KPHFJSNJFBVIEV-UHFFFAOYSA-O |
| XLogP | 10.01 |
| TPSA | 35.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.35 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|