C43H41N2O2+ — CID 76796653
3-[2-[5-(3-benzyl-1,3-dimethylphenanthro[9,10-b]pyrrol-2-ylidene)penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]propanoic acid (PubChem CID 76796653) has the molecular formula C43H41N2O2+ and a molecular weight of 617.81 g/mol. Its IUPAC name is 3-[2-[5-(3-benzyl-1,3-dimethylphenanthro[9,10-b]pyrrol-2-ylidene)penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]propanoic acid.
| Compound Name | 3-[2-[5-(3-benzyl-1,3-dimethylphenanthro[9,10-b]pyrrol-2-ylidene)penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]propanoic acid |
|---|---|
| PubChem CID | 76796653 |
| Molecular Formula | C43H41N2O2+ |
| Molecular Weight | 617.81 g/mol |
| Exact Mass | 617.32 |
| IUPAC Name | 3-[2-[5-(3-benzyl-1,3-dimethylphenanthro[9,10-b]pyrrol-2-ylidene)penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]propanoic acid |
| SMILES | CN1C(=CC=CC=CC2=[N+](CCC(=O)O)c3ccccc3C2(C)C)C(C)(Cc2ccccc2)c2c1c1ccccc1c1ccccc21 |
| InChI | InChI=1S/C43H40N2O2/c1-42(2)35-23-15-16-24-36(35)45(28-27-39(46)47)37(42)25-9-6-10-26-38-43(3,29-30-17-7-5-8-18-30)40-33-21-13-11-19-31(33)32-20-12-14-22-34(32)41(40)44(38)4/h5-26H,27-29H2,1-4H3/p+1 |
| InChIKey | BIZVJKOZFZRREC-UHFFFAOYSA-O |
| XLogP | 9.49 |
| TPSA | 43.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.81 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|