C47H47N2O4+ — CID 76796722
3-[2-[5-[1-(2-formyloxyethyl)-3,3,5-trimethylindol-1-ium-2-yl]-3-phenylhexa-2,4-dienylidene]-3,3-dimethylphenanthro[9,10-b]pyrrol-1-yl]propanoic acid (PubChem CID 76796722) has the molecular formula C47H47N2O4+ and a molecular weight of 703.90 g/mol. Its IUPAC name is 3-[2-[5-[1-(2-formyloxyethyl)-3,3,5-trimethylindol-1-ium-2-yl]-3-phenylhexa-2,4-dienylidene]-3,3-dimethylphenanthro[9,10-b]pyrrol-1-yl]propanoic acid.
| Compound Name | 3-[2-[5-[1-(2-formyloxyethyl)-3,3,5-trimethylindol-1-ium-2-yl]-3-phenylhexa-2,4-dienylidene]-3,3-dimethylphenanthro[9,10-b]pyrrol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 76796722 |
| Molecular Formula | C47H47N2O4+ |
| Molecular Weight | 703.90 g/mol |
| Exact Mass | 703.35 |
| IUPAC Name | 3-[2-[5-[1-(2-formyloxyethyl)-3,3,5-trimethylindol-1-ium-2-yl]-3-phenylhexa-2,4-dienylidene]-3,3-dimethylphenanthro[9,10-b]pyrrol-1-yl]propanoic acid |
| SMILES | CC(=CC(=CC=C1N(CCC(=O)O)c2c(c3ccccc3c3ccccc23)C1(C)C)c1ccccc1)C1=[N+](CCOC=O)c2ccc(C)cc2C1(C)C |
| InChI | InChI=1S/C47H46N2O4/c1-31-20-22-40-39(28-31)46(3,4)45(48(40)26-27-53-30-50)32(2)29-34(33-14-8-7-9-15-33)21-23-41-47(5,6)43-37-18-12-10-16-35(37)36-17-11-13-19-38(36)44(43)49(41)25-24-42(51)52/h7-23,28-30H,24-27H2,1-6H3/p+1 |
| InChIKey | FLQBDTPCMZDTSS-UHFFFAOYSA-O |
| XLogP | 10.04 |
| TPSA | 69.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.90 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|