C35H32BrN2O4Se+ — CID 58471317
3-[(2E)-3-[(Z)-2-bromobut-2-enyl]-2-[[3-(2-carboxyethyl)-1,3-benzoselenazol-3-ium-2-yl]methylidene]-3-methylphenanthro[9,10-b]pyrrol-1-yl]propanoic acid (PubChem CID 58471317) has the molecular formula C35H32BrN2O4Se+ and a molecular weight of 703.52 g/mol. Its IUPAC name is 3-[(2E)-3-[(Z)-2-bromobut-2-enyl]-2-[[3-(2-carboxyethyl)-1,3-benzoselenazol-3-ium-2-yl]methylidene]-3-methylphenanthro[9,10-b]pyrrol-1-yl]propanoic acid.
| Compound Name | 3-[(2E)-3-[(Z)-2-bromobut-2-enyl]-2-[[3-(2-carboxyethyl)-1,3-benzoselenazol-3-ium-2-yl]methylidene]-3-methylphenanthro[9,10-b]pyrrol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 58471317 |
| Molecular Formula | C35H32BrN2O4Se+ |
| Molecular Weight | 703.52 g/mol |
| Exact Mass | 703.07 |
| IUPAC Name | 3-[(2E)-3-[(Z)-2-bromobut-2-enyl]-2-[[3-(2-carboxyethyl)-1,3-benzoselenazol-3-ium-2-yl]methylidene]-3-methylphenanthro[9,10-b]pyrrol-1-yl]propanoic acid |
| SMILES | C/C=C(\Br)CC1(C)/C(=C\c2[se]c3ccccc3[n+]2CCC(=O)O)N(CCC(=O)O)c2c1c1ccccc1c1ccccc21 |
| InChI | InChI=1S/C35H31BrN2O4Se/c1-3-22(36)21-35(2)29(20-30-37(18-16-31(39)40)27-14-8-9-15-28(27)43-30)38(19-17-32(41)42)34-26-13-7-5-11-24(26)23-10-4-6-12-25(23)33(34)35/h3-15,20H,16-19,21H2,1-2H3,(H-,39,40,41,42)/p+1/b22-3- |
| InChIKey | UKIZTUADOKFNOH-XQFZAKLLSA-O |
| XLogP | 7.25 |
| TPSA | 81.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.52 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|