C46H41N2O7+ — CID 76796606
2-[[2-[5-[1-(2-carboxyethyl)-3-methyl-3-prop-2-enylphenanthro[9,10-b]pyrrol-2-ylidene]penta-1,3-dienyl]-5-phenyl-1,3-benzoxazol-3-ium-3-yl]methyl]butanedioic acid (PubChem CID 76796606) has the molecular formula C46H41N2O7+ and a molecular weight of 733.84 g/mol. Its IUPAC name is 2-[[2-[5-[1-(2-carboxyethyl)-3-methyl-3-prop-2-enylphenanthro[9,10-b]pyrrol-2-ylidene]penta-1,3-dienyl]-5-phenyl-1,3-benzoxazol-3-ium-3-yl]methyl]butanedioic acid.
| Compound Name | 2-[[2-[5-[1-(2-carboxyethyl)-3-methyl-3-prop-2-enylphenanthro[9,10-b]pyrrol-2-ylidene]penta-1,3-dienyl]-5-phenyl-1,3-benzoxazol-3-ium-3-yl]methyl]butanedioic acid |
|---|---|
| PubChem CID | 76796606 |
| Molecular Formula | C46H41N2O7+ |
| Molecular Weight | 733.84 g/mol |
| Exact Mass | 733.29 |
| IUPAC Name | 2-[[2-[5-[1-(2-carboxyethyl)-3-methyl-3-prop-2-enylphenanthro[9,10-b]pyrrol-2-ylidene]penta-1,3-dienyl]-5-phenyl-1,3-benzoxazol-3-ium-3-yl]methyl]butanedioic acid |
| SMILES | C=CCC1(C)C(=CC=CC=Cc2oc3ccc(-c4ccccc4)cc3[n+]2CC(CC(=O)O)C(=O)O)N(CCC(=O)O)c2c1c1ccccc1c1ccccc21 |
| InChI | InChI=1S/C46H40N2O7/c1-3-25-46(2)39(47(26-24-41(49)50)44-36-19-13-11-17-34(36)33-16-10-12-18-35(33)43(44)46)20-8-5-9-21-40-48(29-32(45(53)54)28-42(51)52)37-27-31(22-23-38(37)55-40)30-14-6-4-7-15-30/h3-23,27,32H,1,24-26,28-29H2,2H3,(H2-,49,50,51,52,53,54)/p+1 |
| InChIKey | QKUYGSOYEORULH-UHFFFAOYSA-O |
| XLogP | 9.15 |
| TPSA | 132.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.84 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|