C16H15Cl2NOSSe — CID 6437537
2-[(Z)-2-chloro-2-thiophen-2-ylethenyl]-3-ethyl-5-methoxy-1,3-benzoselenazol-3-ium chloride (PubChem CID 6437537) has the molecular formula C16H15Cl2NOSSe and a molecular weight of 419.24 g/mol. Its IUPAC name is 2-[(Z)-2-chloro-2-thiophen-2-ylethenyl]-3-ethyl-5-methoxy-1,3-benzoselenazol-3-ium chloride.
| Compound Name | 2-[(Z)-2-chloro-2-thiophen-2-ylethenyl]-3-ethyl-5-methoxy-1,3-benzoselenazol-3-ium chloride |
|---|---|
| PubChem CID | 6437537 |
| Molecular Formula | C16H15Cl2NOSSe |
| Molecular Weight | 419.24 g/mol |
| Exact Mass | 418.94 |
| IUPAC Name | 2-[(Z)-2-chloro-2-thiophen-2-ylethenyl]-3-ethyl-5-methoxy-1,3-benzoselenazol-3-ium chloride |
| SMILES | CC[n+]1c(/C=C(\Cl)c2cccs2)[se]c2ccc(OC)cc21.[Cl-] |
| InChI | InChI=1S/C16H15ClNOSSe.ClH/c1-3-18-13-9-11(19-2)6-7-15(13)21-16(18)10-12(17)14-5-4-8-20-14;/h4-10H,3H2,1-2H3;1H/q+1;/p-1/b12-10-; |
| InChIKey | QKAIGMPYDMMLEB-BBJSDXRSSA-M |
| XLogP | 1.02 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.24 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|