C15H10N4O4S — CID 135958393
N-(3-cyano-6-methoxy-1,4-dioxidoquinoxaline-1,4-diium-2-yl)thiophene-2-carboxamide (PubChem CID 135958393) has the molecular formula C15H10N4O4S and a molecular weight of 342.34 g/mol. Its IUPAC name is N-(3-cyano-6-methoxy-1,4-dioxidoquinoxaline-1,4-diium-2-yl)thiophene-2-carboxamide.
| Compound Name | N-(3-cyano-6-methoxy-1,4-dioxidoquinoxaline-1,4-diium-2-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 135958393 |
| Molecular Formula | C15H10N4O4S |
| Molecular Weight | 342.34 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | N-(3-cyano-6-methoxy-1,4-dioxidoquinoxaline-1,4-diium-2-yl)thiophene-2-carboxamide |
| SMILES | COc1ccc2c(c1)[n+]([O-])c(C#N)c(NC(=O)c1cccs1)[n+]2[O-] |
| InChI | InChI=1S/C15H10N4O4S/c1-23-9-4-5-10-11(7-9)18(21)12(8-16)14(19(10)22)17-15(20)13-3-2-6-24-13/h2-7H,1H3,(H,17,20) |
| InChIKey | ZXZUWOQAZVXCHZ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.34 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|