C18H14N4O2S — CID 1141365
N-[2-(4-methoxyphenyl)benzotriazol-5-yl]thiophene-2-carboxamide (PubChem CID 1141365) has the molecular formula C18H14N4O2S and a molecular weight of 350.40 g/mol. Its IUPAC name is N-[2-(4-methoxyphenyl)benzotriazol-5-yl]thiophene-2-carboxamide.
| Compound Name | N-[2-(4-methoxyphenyl)benzotriazol-5-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 1141365 |
| Molecular Formula | C18H14N4O2S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | N-[2-(4-methoxyphenyl)benzotriazol-5-yl]thiophene-2-carboxamide |
| SMILES | COc1ccc(-n2nc3ccc(NC(=O)c4cccs4)cc3n2)cc1 |
| InChI | InChI=1S/C18H14N4O2S/c1-24-14-7-5-13(6-8-14)22-20-15-9-4-12(11-16(15)21-22)19-18(23)17-3-2-10-25-17/h2-11H,1H3,(H,19,23) |
| InChIKey | TXYYERSEJDAIKV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |