C20H17N5OS2 — CID 1340943
N-[[2-(4-ethylphenyl)benzotriazol-5-yl]carbamothioyl]thiophene-2-carboxamide (PubChem CID 1340943) has the molecular formula C20H17N5OS2 and a molecular weight of 407.52 g/mol. Its IUPAC name is N-[[2-(4-ethylphenyl)benzotriazol-5-yl]carbamothioyl]thiophene-2-carboxamide.
| Compound Name | N-[[2-(4-ethylphenyl)benzotriazol-5-yl]carbamothioyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 1340943 |
| Molecular Formula | C20H17N5OS2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | N-[[2-(4-ethylphenyl)benzotriazol-5-yl]carbamothioyl]thiophene-2-carboxamide |
| SMILES | CCc1ccc(-n2nc3ccc(NC(=S)NC(=O)c4cccs4)cc3n2)cc1 |
| InChI | InChI=1S/C20H17N5OS2/c1-2-13-5-8-15(9-6-13)25-23-16-10-7-14(12-17(16)24-25)21-20(27)22-19(26)18-4-3-11-28-18/h3-12H,2H2,1H3,(H2,21,22,26,27) |
| InChIKey | OVKOCECZVJCRNM-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|