C17H16N4O3S — CID 51999156
N-(4-methoxyphenyl)-1-methyl-5-(thiophene-2-carbonylamino)pyrazole-3-carboxamide (PubChem CID 51999156) has the molecular formula C17H16N4O3S and a molecular weight of 356.41 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-1-methyl-5-(thiophene-2-carbonylamino)pyrazole-3-carboxamide.
| Compound Name | N-(4-methoxyphenyl)-1-methyl-5-(thiophene-2-carbonylamino)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 51999156 |
| Molecular Formula | C17H16N4O3S |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | N-(4-methoxyphenyl)-1-methyl-5-(thiophene-2-carbonylamino)pyrazole-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cc(NC(=O)c3cccs3)n(C)n2)cc1 |
| InChI | InChI=1S/C17H16N4O3S/c1-21-15(19-17(23)14-4-3-9-25-14)10-13(20-21)16(22)18-11-5-7-12(24-2)8-6-11/h3-10H,1-2H3,(H,18,22)(H,19,23) |
| InChIKey | OUNLDMYBXKEHGQ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |