C18H18N4O3S — CID 51999191
N-[(4-methoxyphenyl)methyl]-1-methyl-5-(thiophene-2-carbonylamino)pyrazole-3-carboxamide (PubChem CID 51999191) has the molecular formula C18H18N4O3S and a molecular weight of 370.43 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-1-methyl-5-(thiophene-2-carbonylamino)pyrazole-3-carboxamide.
| Compound Name | N-[(4-methoxyphenyl)methyl]-1-methyl-5-(thiophene-2-carbonylamino)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 51999191 |
| Molecular Formula | C18H18N4O3S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-1-methyl-5-(thiophene-2-carbonylamino)pyrazole-3-carboxamide |
| SMILES | COc1ccc(CNC(=O)c2cc(NC(=O)c3cccs3)n(C)n2)cc1 |
| InChI | InChI=1S/C18H18N4O3S/c1-22-16(20-18(24)15-4-3-9-26-15)10-14(21-22)17(23)19-11-12-5-7-13(25-2)8-6-12/h3-10H,11H2,1-2H3,(H,19,23)(H,20,24) |
| InChIKey | SAGQHEGFCZCMCP-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |