C25H27N2S+ — CID 146051138
3-ethyl-2-[(Z)-(1-ethyl-6-methylquinolin-2-ylidene)methyl]-4-(4-methylphenyl)-1,3-thiazol-3-ium (PubChem CID 146051138) has the molecular formula C25H27N2S+ and a molecular weight of 387.57 g/mol. Its IUPAC name is 3-ethyl-2-[(Z)-(1-ethyl-6-methylquinolin-2-ylidene)methyl]-4-(4-methylphenyl)-1,3-thiazol-3-ium.
| Compound Name | 3-ethyl-2-[(Z)-(1-ethyl-6-methylquinolin-2-ylidene)methyl]-4-(4-methylphenyl)-1,3-thiazol-3-ium |
|---|---|
| PubChem CID | 146051138 |
| Molecular Formula | C25H27N2S+ |
| Molecular Weight | 387.57 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 3-ethyl-2-[(Z)-(1-ethyl-6-methylquinolin-2-ylidene)methyl]-4-(4-methylphenyl)-1,3-thiazol-3-ium |
| SMILES | CCN1/C(=C\c2scc(-c3ccc(C)cc3)[n+]2CC)C=Cc2cc(C)ccc21 |
| InChI | InChI=1S/C25H27N2S/c1-5-26-22(13-12-21-15-19(4)9-14-23(21)26)16-25-27(6-2)24(17-28-25)20-10-7-18(3)8-11-20/h7-17H,5-6H2,1-4H3/q+1 |
| InChIKey | JJVTUYYHXAISLG-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.57 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|