C23H23N2O+ — CID 135848158
3-ethyl-2-[(E)-(1-ethylquinolin-2-ylidene)methyl]-4-phenyl-1,3-oxazol-3-ium (PubChem CID 135848158) has the molecular formula C23H23N2O+ and a molecular weight of 343.45 g/mol. Its IUPAC name is 3-ethyl-2-[(E)-(1-ethylquinolin-2-ylidene)methyl]-4-phenyl-1,3-oxazol-3-ium.
| Compound Name | 3-ethyl-2-[(E)-(1-ethylquinolin-2-ylidene)methyl]-4-phenyl-1,3-oxazol-3-ium |
|---|---|
| PubChem CID | 135848158 |
| Molecular Formula | C23H23N2O+ |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 3-ethyl-2-[(E)-(1-ethylquinolin-2-ylidene)methyl]-4-phenyl-1,3-oxazol-3-ium |
| SMILES | CCN1/C(=C/c2occ(-c3ccccc3)[n+]2CC)C=Cc2ccccc21 |
| InChI | InChI=1S/C23H23N2O/c1-3-24-20(15-14-19-12-8-9-13-21(19)24)16-23-25(4-2)22(17-26-23)18-10-6-5-7-11-18/h5-17H,3-4H2,1-2H3/q+1 |
| InChIKey | NRJRRJATZSFTJC-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 20.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|