C16H17IN2S — CID 74337192
2-[(1-ethylquinolin-2-ylidene)methyl]-3-methyl-1,3-thiazol-3-ium iodide (PubChem CID 74337192) has the molecular formula C16H17IN2S and a molecular weight of 396.30 g/mol. Its IUPAC name is 2-[(1-ethylquinolin-2-ylidene)methyl]-3-methyl-1,3-thiazol-3-ium iodide.
| Compound Name | 2-[(1-ethylquinolin-2-ylidene)methyl]-3-methyl-1,3-thiazol-3-ium iodide |
|---|---|
| PubChem CID | 74337192 |
| Molecular Formula | C16H17IN2S |
| Molecular Weight | 396.30 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | 2-[(1-ethylquinolin-2-ylidene)methyl]-3-methyl-1,3-thiazol-3-ium iodide |
| SMILES | CCN1C(=Cc2scc[n+]2C)C=Cc2ccccc21.[I-] |
| InChI | InChI=1S/C16H17N2S.HI/c1-3-18-14(12-16-17(2)10-11-19-16)9-8-13-6-4-5-7-15(13)18;/h4-12H,3H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | HAAAIWRTZGXXBB-UHFFFAOYSA-M |
| XLogP | 0.47 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.30 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|