C29H28N2O3-2 — CID 140604026
2,4-bis[(E)-(1-ethylquinolin-2-ylidene)methyl]-5-oxocyclopentane-1,3-diolate (PubChem CID 140604026) has the molecular formula C29H28N2O3-2 and a molecular weight of 452.55 g/mol. Its IUPAC name is 2,4-bis[(E)-(1-ethylquinolin-2-ylidene)methyl]-5-oxocyclopentane-1,3-diolate.
| Compound Name | 2,4-bis[(E)-(1-ethylquinolin-2-ylidene)methyl]-5-oxocyclopentane-1,3-diolate |
|---|---|
| PubChem CID | 140604026 |
| Molecular Formula | C29H28N2O3-2 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 2,4-bis[(E)-(1-ethylquinolin-2-ylidene)methyl]-5-oxocyclopentane-1,3-diolate |
| SMILES | CCN1/C(=C/C2C(=O)C([O-])C(/C=C3\C=Cc4ccccc4N3CC)C2[O-])C=Cc2ccccc21 |
| InChI | InChI=1S/C29H28N2O3/c1-3-30-21(15-13-19-9-5-7-11-25(19)30)17-23-27(32)24(29(34)28(23)33)18-22-16-14-20-10-6-8-12-26(20)31(22)4-2/h5-18,23-24,27-28H,3-4H2,1-2H3/q-2/b21-17+,22-18+ |
| InChIKey | QKQQJARFFCIJIS-KSTNYAOJSA-N |
| XLogP | 3.13 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |