C23H23N2S2+ — CID 4294456
1-ethyl-2-[(1-ethylquinolin-2-ylidene)methyl]-4,5-dihydrothieno[3,2-e][1,3]benzothiazol-1-ium (PubChem CID 4294456) has the molecular formula C23H23N2S2+ and a molecular weight of 391.59 g/mol. Its IUPAC name is 1-ethyl-2-[(1-ethylquinolin-2-ylidene)methyl]-4,5-dihydrothieno[3,2-e][1,3]benzothiazol-1-ium.
| Compound Name | 1-ethyl-2-[(1-ethylquinolin-2-ylidene)methyl]-4,5-dihydrothieno[3,2-e][1,3]benzothiazol-1-ium |
|---|---|
| PubChem CID | 4294456 |
| Molecular Formula | C23H23N2S2+ |
| Molecular Weight | 391.59 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 1-ethyl-2-[(1-ethylquinolin-2-ylidene)methyl]-4,5-dihydrothieno[3,2-e][1,3]benzothiazol-1-ium |
| SMILES | CCN1C(=Cc2sc3c([n+]2CC)-c2ccsc2CC3)C=Cc2ccccc21 |
| InChI | InChI=1S/C23H23N2S2/c1-3-24-17(10-9-16-7-5-6-8-19(16)24)15-22-25(4-2)23-18-13-14-26-20(18)11-12-21(23)27-22/h5-10,13-15H,3-4,11-12H2,1-2H3/q+1 |
| InChIKey | VKNRCZGMPNSZKI-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.59 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|