C20H21NO3S — CID 118545445
3-(3-methoxy-7-methylphenothiazin-10-yl)propyl prop-2-enoate (PubChem CID 118545445) has the molecular formula C20H21NO3S and a molecular weight of 355.46 g/mol. Its IUPAC name is 3-(3-methoxy-7-methylphenothiazin-10-yl)propyl prop-2-enoate.
| Compound Name | 3-(3-methoxy-7-methylphenothiazin-10-yl)propyl prop-2-enoate |
|---|---|
| PubChem CID | 118545445 |
| Molecular Formula | C20H21NO3S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 3-(3-methoxy-7-methylphenothiazin-10-yl)propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCN1c2ccc(C)cc2Sc2cc(OC)ccc21 |
| InChI | InChI=1S/C20H21NO3S/c1-4-20(22)24-11-5-10-21-16-8-6-14(2)12-18(16)25-19-13-15(23-3)7-9-17(19)21/h4,6-9,12-13H,1,5,10-11H2,2-3H3 |
| InChIKey | DIQOSXAWBSQACZ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|