C81H77N3O8S — CID 139339353
3-N,3-N,7-N,7-N-tetrakis[2,2-bis(4-methoxyphenyl)ethenyl]-10-pentylphenothiazine-3,7-diamine (PubChem CID 139339353) has the molecular formula C81H77N3O8S and a molecular weight of 1252.59 g/mol. Its IUPAC name is 3-N,3-N,7-N,7-N-tetrakis[2,2-bis(4-methoxyphenyl)ethenyl]-10-pentylphenothiazine-3,7-diamine.
| Compound Name | 3-N,3-N,7-N,7-N-tetrakis[2,2-bis(4-methoxyphenyl)ethenyl]-10-pentylphenothiazine-3,7-diamine |
|---|---|
| PubChem CID | 139339353 |
| Molecular Formula | C81H77N3O8S |
| Molecular Weight | 1252.59 g/mol |
| Exact Mass | 1251.54 |
| IUPAC Name | 3-N,3-N,7-N,7-N-tetrakis[2,2-bis(4-methoxyphenyl)ethenyl]-10-pentylphenothiazine-3,7-diamine |
| SMILES | CCCCCN1c2ccc(N(C=C(c3ccc(OC)cc3)c3ccc(OC)cc3)C=C(c3ccc(OC)cc3)c3ccc(OC)cc3)cc2Sc2cc(N(C=C(c3ccc(OC)cc3)c3ccc(OC)cc3)C=C(c3ccc(OC)cc3)c3ccc(OC)cc3)ccc21 |
| InChI | InChI=1S/C81H77N3O8S/c1-10-11-12-49-84-78-47-29-64(82(52-74(56-13-31-66(85-2)32-14-56)57-15-33-67(86-3)34-16-57)53-75(58-17-35-68(87-4)36-18-58)59-19-37-69(88-5)38-20-59)50-80(78)93-81-51-65(30-48-79(81)84)83(54-76(60-21-39-70(89-6)40-22-60)61-23-41-71(90-7)42-24-61)55-77(62-25-43-72(91-8)44-26-62)63-27-45-73(92-9)46-28-63/h13-48,50-55H,10-12,49H2,1-9H3 |
| InChIKey | KDCDYYGOTVJVGM-UHFFFAOYSA-N |
| XLogP | 19.52 |
| TPSA | 83.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 93 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1252.59 |
| LogP ≤ 5 | 19.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|