C22H28N2O3S — CID 134285179
3-(dibutylamino)-7-methoxyphenothiazine-10-carboxylic acid (PubChem CID 134285179) has the molecular formula C22H28N2O3S and a molecular weight of 400.54 g/mol. Its IUPAC name is 3-(dibutylamino)-7-methoxyphenothiazine-10-carboxylic acid.
| Compound Name | 3-(dibutylamino)-7-methoxyphenothiazine-10-carboxylic acid |
|---|---|
| PubChem CID | 134285179 |
| Molecular Formula | C22H28N2O3S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 3-(dibutylamino)-7-methoxyphenothiazine-10-carboxylic acid |
| SMILES | CCCCN(CCCC)c1ccc2c(c1)Sc1cc(OC)ccc1N2C(=O)O |
| InChI | InChI=1S/C22H28N2O3S/c1-4-6-12-23(13-7-5-2)16-8-10-18-20(14-16)28-21-15-17(27-3)9-11-19(21)24(18)22(25)26/h8-11,14-15H,4-7,12-13H2,1-3H3,(H,25,26) |
| InChIKey | JFXRTAFENSAATP-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |