C17H18ClN3OS — CID 23558007
3,7-bis(dimethylamino)phenothiazine-10-carbonyl chloride (PubChem CID 23558007) has the molecular formula C17H18ClN3OS and a molecular weight of 347.87 g/mol. Its IUPAC name is 3,7-bis(dimethylamino)phenothiazine-10-carbonyl chloride.
| Compound Name | 3,7-bis(dimethylamino)phenothiazine-10-carbonyl chloride |
|---|---|
| PubChem CID | 23558007 |
| Molecular Formula | C17H18ClN3OS |
| Molecular Weight | 347.87 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 3,7-bis(dimethylamino)phenothiazine-10-carbonyl chloride |
| SMILES | CN(C)c1ccc2c(c1)Sc1cc(N(C)C)ccc1N2C(=O)Cl |
| InChI | InChI=1S/C17H18ClN3OS/c1-19(2)11-5-7-13-15(9-11)23-16-10-12(20(3)4)6-8-14(16)21(13)17(18)22/h5-10H,1-4H3 |
| InChIKey | GIPFZQCSGPTPQF-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.87 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|