C21H27N5O5S2 — CID 24895843
2-[[2-[[3,7-bis(dimethylamino)phenothiazine-10-carbonyl]amino]acetyl]amino]ethanesulfonic acid (PubChem CID 24895843) has the molecular formula C21H27N5O5S2 and a molecular weight of 493.61 g/mol. Its IUPAC name is 2-[[2-[[3,7-bis(dimethylamino)phenothiazine-10-carbonyl]amino]acetyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[2-[[3,7-bis(dimethylamino)phenothiazine-10-carbonyl]amino]acetyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 24895843 |
| Molecular Formula | C21H27N5O5S2 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | 2-[[2-[[3,7-bis(dimethylamino)phenothiazine-10-carbonyl]amino]acetyl]amino]ethanesulfonic acid |
| SMILES | CN(C)c1ccc2c(c1)Sc1cc(N(C)C)ccc1N2C(=O)NCC(=O)NCCS(=O)(=O)O |
| InChI | InChI=1S/C21H27N5O5S2/c1-24(2)14-5-7-16-18(11-14)32-19-12-15(25(3)4)6-8-17(19)26(16)21(28)23-13-20(27)22-9-10-33(29,30)31/h5-8,11-12H,9-10,13H2,1-4H3,(H,22,27)(H,23,28)(H,29,30,31) |
| InChIKey | QHWDPEGGUBTNFS-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 122.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|