C23H30N4O3S — CID 139461111
ethyl 4-[[3,7-bis(dimethylamino)phenothiazine-10-carbonyl]amino]butanoate (PubChem CID 139461111) has the molecular formula C23H30N4O3S and a molecular weight of 442.59 g/mol. Its IUPAC name is ethyl 4-[[3,7-bis(dimethylamino)phenothiazine-10-carbonyl]amino]butanoate.
| Compound Name | ethyl 4-[[3,7-bis(dimethylamino)phenothiazine-10-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 139461111 |
| Molecular Formula | C23H30N4O3S |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | ethyl 4-[[3,7-bis(dimethylamino)phenothiazine-10-carbonyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)N1c2ccc(N(C)C)cc2Sc2cc(N(C)C)ccc21 |
| InChI | InChI=1S/C23H30N4O3S/c1-6-30-22(28)8-7-13-24-23(29)27-18-11-9-16(25(2)3)14-20(18)31-21-15-17(26(4)5)10-12-19(21)27/h9-12,14-15H,6-8,13H2,1-5H3,(H,24,29) |
| InChIKey | GAFCYWIFXDCNMS-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|