C19H23N4O4S2- — CID 153427895
2-[[3,7-bis(dimethylamino)phenothiazine-10-carbonyl]amino]ethanesulfonate (PubChem CID 153427895) has the molecular formula C19H23N4O4S2- and a molecular weight of 435.55 g/mol. Its IUPAC name is 2-[[3,7-bis(dimethylamino)phenothiazine-10-carbonyl]amino]ethanesulfonate.
| Compound Name | 2-[[3,7-bis(dimethylamino)phenothiazine-10-carbonyl]amino]ethanesulfonate |
|---|---|
| PubChem CID | 153427895 |
| Molecular Formula | C19H23N4O4S2- |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | 2-[[3,7-bis(dimethylamino)phenothiazine-10-carbonyl]amino]ethanesulfonate |
| SMILES | CN(C)c1ccc2c(c1)Sc1cc(N(C)C)ccc1N2C(=O)NCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C19H24N4O4S2/c1-21(2)13-5-7-15-17(11-13)28-18-12-14(22(3)4)6-8-16(18)23(15)19(24)20-9-10-29(25,26)27/h5-8,11-12H,9-10H2,1-4H3,(H,20,24)(H,25,26,27)/p-1 |
| InChIKey | AMLACSJTJBOIKZ-UHFFFAOYSA-M |
| XLogP | 2.68 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|