C35H46ClN3OS — CID 23375105
[3,7-bis(dibutylamino)phenothiazin-10-yl]-(4-chlorophenyl)methanone (PubChem CID 23375105) has the molecular formula C35H46ClN3OS and a molecular weight of 592.29 g/mol. Its IUPAC name is [3,7-bis(dibutylamino)phenothiazin-10-yl]-(4-chlorophenyl)methanone.
| Compound Name | [3,7-bis(dibutylamino)phenothiazin-10-yl]-(4-chlorophenyl)methanone |
|---|---|
| PubChem CID | 23375105 |
| Molecular Formula | C35H46ClN3OS |
| Molecular Weight | 592.29 g/mol |
| Exact Mass | 591.31 |
| IUPAC Name | [3,7-bis(dibutylamino)phenothiazin-10-yl]-(4-chlorophenyl)methanone |
| SMILES | CCCCN(CCCC)c1ccc2c(c1)Sc1cc(N(CCCC)CCCC)ccc1N2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C35H46ClN3OS/c1-5-9-21-37(22-10-6-2)29-17-19-31-33(25-29)41-34-26-30(38(23-11-7-3)24-12-8-4)18-20-32(34)39(31)35(40)27-13-15-28(36)16-14-27/h13-20,25-26H,5-12,21-24H2,1-4H3 |
| InChIKey | DDDMKYLHIXDOKO-UHFFFAOYSA-N |
| XLogP | 10.60 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.29 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |