C34H39ClN6OS2 — CID 159676609
1-[3,7-bis(dimethylamino)phenothiazin-10-yl]ethanone;[7-(dimethylamino)phenothiazin-3-ylidene]-dimethylazanium;chloride (PubChem CID 159676609) has the molecular formula C34H39ClN6OS2 and a molecular weight of 647.31 g/mol. Its IUPAC name is 1-[3,7-bis(dimethylamino)phenothiazin-10-yl]ethanone;[7-(dimethylamino)phenothiazin-3-ylidene]-dimethylazanium;chloride.
| Compound Name | 1-[3,7-bis(dimethylamino)phenothiazin-10-yl]ethanone;[7-(dimethylamino)phenothiazin-3-ylidene]-dimethylazanium;chloride |
|---|---|
| PubChem CID | 159676609 |
| Molecular Formula | C34H39ClN6OS2 |
| Molecular Weight | 647.31 g/mol |
| Exact Mass | 646.23 |
| IUPAC Name | 1-[3,7-bis(dimethylamino)phenothiazin-10-yl]ethanone;[7-(dimethylamino)phenothiazin-3-ylidene]-dimethylazanium;chloride |
| SMILES | CC(=O)N1c2ccc(N(C)C)cc2Sc2cc(N(C)C)ccc21.CN(C)c1ccc2nc3ccc(=[N+](C)C)cc-3sc2c1.[Cl-] |
| InChI | InChI=1S/C18H21N3OS.C16H18N3S.ClH/c1-12(22)21-15-8-6-13(19(2)3)10-17(15)23-18-11-14(20(4)5)7-9-16(18)21;1-18(2)11-5-7-13-15(9-11)20-16-10-12(19(3)4)6-8-14(16)17-13;/h6-11H,1-5H3;5-10H,1-4H3;1H/q;+1;/p-1 |
| InChIKey | BEXPPBQUTRKAGA-UHFFFAOYSA-M |
| XLogP | 3.47 |
| TPSA | 45.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|