C19H24N3S+ — CID 171469979
[7-[tert-butyl(methyl)amino]phenothiazin-3-ylidene]-dimethylazanium (PubChem CID 171469979) has the molecular formula C19H24N3S+ and a molecular weight of 326.49 g/mol. Its IUPAC name is [7-[tert-butyl(methyl)amino]phenothiazin-3-ylidene]-dimethylazanium.
| Compound Name | [7-[tert-butyl(methyl)amino]phenothiazin-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 171469979 |
| Molecular Formula | C19H24N3S+ |
| Molecular Weight | 326.49 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | [7-[tert-butyl(methyl)amino]phenothiazin-3-ylidene]-dimethylazanium |
| SMILES | CN(c1ccc2nc3ccc(=[N+](C)C)cc-3sc2c1)C(C)(C)C |
| InChI | InChI=1S/C19H24N3S/c1-19(2,3)22(6)14-8-10-16-18(12-14)23-17-11-13(21(4)5)7-9-15(17)20-16/h7-12H,1-6H3/q+1 |
| InChIKey | LBIMOXFPKNSKAK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 19.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|