C40H37NO6 — CID 139339928
N,N-bis[2,2-bis(4-methoxyphenyl)ethenyl]-2,3-dihydro-1,4-benzodioxin-6-amine (PubChem CID 139339928) has the molecular formula C40H37NO6 and a molecular weight of 627.74 g/mol. Its IUPAC name is N,N-bis[2,2-bis(4-methoxyphenyl)ethenyl]-2,3-dihydro-1,4-benzodioxin-6-amine.
| Compound Name | N,N-bis[2,2-bis(4-methoxyphenyl)ethenyl]-2,3-dihydro-1,4-benzodioxin-6-amine |
|---|---|
| PubChem CID | 139339928 |
| Molecular Formula | C40H37NO6 |
| Molecular Weight | 627.74 g/mol |
| Exact Mass | 627.26 |
| IUPAC Name | N,N-bis[2,2-bis(4-methoxyphenyl)ethenyl]-2,3-dihydro-1,4-benzodioxin-6-amine |
| SMILES | COc1ccc(C(=CN(C=C(c2ccc(OC)cc2)c2ccc(OC)cc2)c2ccc3c(c2)OCCO3)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C40H37NO6/c1-42-33-14-5-28(6-15-33)37(29-7-16-34(43-2)17-8-29)26-41(32-13-22-39-40(25-32)47-24-23-46-39)27-38(30-9-18-35(44-3)19-10-30)31-11-20-36(45-4)21-12-31/h5-22,25-27H,23-24H2,1-4H3 |
| InChIKey | CLOYORMFVZGIKO-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.74 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |