C30H35N3O8 — CID 102336284
N-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-trien-20-yl)-4-[(4-methoxyphenyl)diazenyl]benzamide (PubChem CID 102336284) has the molecular formula C30H35N3O8 and a molecular weight of 565.62 g/mol. Its IUPAC name is N-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-trien-20-yl)-4-[(4-methoxyphenyl)diazenyl]benzamide.
| Compound Name | N-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-trien-20-yl)-4-[(4-methoxyphenyl)diazenyl]benzamide |
|---|---|
| PubChem CID | 102336284 |
| Molecular Formula | C30H35N3O8 |
| Molecular Weight | 565.62 g/mol |
| Exact Mass | 565.24 |
| IUPAC Name | N-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-trien-20-yl)-4-[(4-methoxyphenyl)diazenyl]benzamide |
| SMILES | COc1ccc(/N=N/c2ccc(C(=O)Nc3ccc4c(c3)OCCOCCOCCOCCOCCO4)cc2)cc1 |
| InChI | InChI=1S/C30H35N3O8/c1-35-27-9-6-25(7-10-27)33-32-24-4-2-23(3-5-24)30(34)31-26-8-11-28-29(22-26)41-21-19-39-17-15-37-13-12-36-14-16-38-18-20-40-28/h2-11,22H,12-21H2,1H3,(H,31,34)/b33-32+ |
| InChIKey | NTEBWCLNGZKIOA-ULIFNZDWSA-N |
| XLogP | 5.20 |
| TPSA | 118.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.62 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|