C22H26N2O5S — CID 76619804
4-prop-2-enoyloxybutyl 2-(3-butyl-6-methoxy-1,3-benzothiazol-2-ylidene)-2-cyanoacetate (PubChem CID 76619804) has the molecular formula C22H26N2O5S and a molecular weight of 430.53 g/mol. Its IUPAC name is 4-prop-2-enoyloxybutyl 2-(3-butyl-6-methoxy-1,3-benzothiazol-2-ylidene)-2-cyanoacetate.
| Compound Name | 4-prop-2-enoyloxybutyl 2-(3-butyl-6-methoxy-1,3-benzothiazol-2-ylidene)-2-cyanoacetate |
|---|---|
| PubChem CID | 76619804 |
| Molecular Formula | C22H26N2O5S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 4-prop-2-enoyloxybutyl 2-(3-butyl-6-methoxy-1,3-benzothiazol-2-ylidene)-2-cyanoacetate |
| SMILES | C=CC(=O)OCCCCOC(=O)C(C#N)=C1Sc2cc(OC)ccc2N1CCCC |
| InChI | InChI=1S/C22H26N2O5S/c1-4-6-11-24-18-10-9-16(27-3)14-19(18)30-21(24)17(15-23)22(26)29-13-8-7-12-28-20(25)5-2/h5,9-10,14H,2,4,6-8,11-13H2,1,3H3 |
| InChIKey | PKROOFJWHNLTMM-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 88.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|