C19H21N3O4 — CID 76619838
2-[[2-(3-butyl-1,3-benzoxazol-2-ylidene)-2-cyanoacetyl]amino]ethyl prop-2-enoate (PubChem CID 76619838) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is 2-[[2-(3-butyl-1,3-benzoxazol-2-ylidene)-2-cyanoacetyl]amino]ethyl prop-2-enoate.
| Compound Name | 2-[[2-(3-butyl-1,3-benzoxazol-2-ylidene)-2-cyanoacetyl]amino]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 76619838 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 2-[[2-(3-butyl-1,3-benzoxazol-2-ylidene)-2-cyanoacetyl]amino]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCNC(=O)C(C#N)=C1Oc2ccccc2N1CCCC |
| InChI | InChI=1S/C19H21N3O4/c1-3-5-11-22-15-8-6-7-9-16(15)26-19(22)14(13-20)18(24)21-10-12-25-17(23)4-2/h4,6-9H,2-3,5,10-12H2,1H3,(H,21,24) |
| InChIKey | BJRLHVQLHFONFZ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|