C29H35N3O8 — CID 89220616
2-[(5E)-3-butyl-5-[(2E)-2-[3-[4-(ethenoxymethoxy)butyl]-1,3-benzoxazol-2-ylidene]ethylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]ethyl prop-2-enoate (PubChem CID 89220616) has the molecular formula C29H35N3O8 and a molecular weight of 553.61 g/mol. Its IUPAC name is 2-[(5E)-3-butyl-5-[(2E)-2-[3-[4-(ethenoxymethoxy)butyl]-1,3-benzoxazol-2-ylidene]ethylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]ethyl prop-2-enoate.
| Compound Name | 2-[(5E)-3-butyl-5-[(2E)-2-[3-[4-(ethenoxymethoxy)butyl]-1,3-benzoxazol-2-ylidene]ethylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 89220616 |
| Molecular Formula | C29H35N3O8 |
| Molecular Weight | 553.61 g/mol |
| Exact Mass | 553.24 |
| IUPAC Name | 2-[(5E)-3-butyl-5-[(2E)-2-[3-[4-(ethenoxymethoxy)butyl]-1,3-benzoxazol-2-ylidene]ethylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]ethyl prop-2-enoate |
| SMILES | C=COCOCCCCN1/C(=C\C=C2/C(=O)N(CCCC)C(=O)N(CCOC(=O)C=C)C2=O)Oc2ccccc21 |
| InChI | InChI=1S/C29H35N3O8/c1-4-7-16-31-27(34)22(28(35)32(29(31)36)18-20-39-26(33)5-2)14-15-25-30(17-10-11-19-38-21-37-6-3)23-12-8-9-13-24(23)40-25/h5-6,8-9,12-15H,2-4,7,10-11,16-21H2,1H3/b22-14+,25-15+ |
| InChIKey | YOJLIQXWCNHKBT-LPHPLFSASA-N |
| XLogP | 3.89 |
| TPSA | 114.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.61 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|