C34H49N3O5 — CID 89220615
(5Z)-5-[(2Z)-2-[1-[4-(ethenoxymethoxy)butyl]-3,3-dimethylindol-2-ylidene]ethylidene]-1-(2-ethylhexyl)-3-propan-2-yl-1,3-diazinane-2,4,6-trione (PubChem CID 89220615) has the molecular formula C34H49N3O5 and a molecular weight of 579.78 g/mol. Its IUPAC name is (5Z)-5-[(2Z)-2-[1-[4-(ethenoxymethoxy)butyl]-3,3-dimethylindol-2-ylidene]ethylidene]-1-(2-ethylhexyl)-3-propan-2-yl-1,3-diazinane-2,4,6-trione.
| Compound Name | (5Z)-5-[(2Z)-2-[1-[4-(ethenoxymethoxy)butyl]-3,3-dimethylindol-2-ylidene]ethylidene]-1-(2-ethylhexyl)-3-propan-2-yl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 89220615 |
| Molecular Formula | C34H49N3O5 |
| Molecular Weight | 579.78 g/mol |
| Exact Mass | 579.37 |
| IUPAC Name | (5Z)-5-[(2Z)-2-[1-[4-(ethenoxymethoxy)butyl]-3,3-dimethylindol-2-ylidene]ethylidene]-1-(2-ethylhexyl)-3-propan-2-yl-1,3-diazinane-2,4,6-trione |
| SMILES | C=COCOCCCCN1/C(=C\C=C2\C(=O)N(CC(CC)CCCC)C(=O)N(C(C)C)C2=O)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C34H49N3O5/c1-8-11-16-26(9-2)23-36-31(38)27(32(39)37(25(4)5)33(36)40)19-20-30-34(6,7)28-17-12-13-18-29(28)35(30)21-14-15-22-42-24-41-10-3/h10,12-13,17-20,25-26H,3,8-9,11,14-16,21-24H2,1-2,4-7H3/b27-19-,30-20- |
| InChIKey | NEEQRWYYGBXTRD-HCVMMTDZSA-N |
| XLogP | 6.92 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.78 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|