C21H31NO2 — CID 18683943
2-ethylhexyl (2E)-2-(1,3,3-trimethylindol-2-ylidene)acetate (PubChem CID 18683943) has the molecular formula C21H31NO2 and a molecular weight of 329.48 g/mol. Its IUPAC name is 2-ethylhexyl (2E)-2-(1,3,3-trimethylindol-2-ylidene)acetate.
| Compound Name | 2-ethylhexyl (2E)-2-(1,3,3-trimethylindol-2-ylidene)acetate |
|---|---|
| PubChem CID | 18683943 |
| Molecular Formula | C21H31NO2 |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | 2-ethylhexyl (2E)-2-(1,3,3-trimethylindol-2-ylidene)acetate |
| SMILES | CCCCC(CC)COC(=O)/C=C1/N(C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C21H31NO2/c1-6-8-11-16(7-2)15-24-20(23)14-19-21(3,4)17-12-9-10-13-18(17)22(19)5/h9-10,12-14,16H,6-8,11,15H2,1-5H3/b19-14+ |
| InChIKey | QCMLCCSLHQMQJX-XMHGGMMESA-N |
| XLogP | 5.06 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|